C17H12N4O3 — CID 110715446
3-cyano-N-[3-(2,5-dioxoimidazolidin-4-yl)phenyl]benzamide (PubChem CID 110715446) has the molecular formula C17H12N4O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is 3-cyano-N-[3-(2,5-dioxoimidazolidin-4-yl)phenyl]benzamide.
| Compound Name | 3-cyano-N-[3-(2,5-dioxoimidazolidin-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 110715446 |
| Molecular Formula | C17H12N4O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3-cyano-N-[3-(2,5-dioxoimidazolidin-4-yl)phenyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2cccc(C3NC(=O)NC3=O)c2)c1 |
| InChI | InChI=1S/C17H12N4O3/c18-9-10-3-1-5-12(7-10)15(22)19-13-6-2-4-11(8-13)14-16(23)21-17(24)20-14/h1-8,14H,(H,19,22)(H2,20,21,23,24) |
| InChIKey | IQXWJYJKXLZZAX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|