C10H10N2O3 — CID 129497891
(3S)-3-(4-hydroxyphenyl)piperazine-2,5-dione (PubChem CID 129497891) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is (3S)-3-(4-hydroxyphenyl)piperazine-2,5-dione.
| Compound Name | (3S)-3-(4-hydroxyphenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 129497891 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (3S)-3-(4-hydroxyphenyl)piperazine-2,5-dione |
| SMILES | O=C1CNC(=O)[C@H](c2ccc(O)cc2)N1 |
| InChI | InChI=1S/C10H10N2O3/c13-7-3-1-6(2-4-7)9-10(15)11-5-8(14)12-9/h1-4,9,13H,5H2,(H,11,15)(H,12,14)/t9-/m0/s1 |
| InChIKey | CCGVZSDXRZQDAT-VIFPVBQESA-N |
| XLogP | -0.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |