C11H12N2O3 — CID 129497711
(3S)-3-(4-hydroxyphenyl)-1-methylpiperazine-2,5-dione (PubChem CID 129497711) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is (3S)-3-(4-hydroxyphenyl)-1-methylpiperazine-2,5-dione.
| Compound Name | (3S)-3-(4-hydroxyphenyl)-1-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 129497711 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (3S)-3-(4-hydroxyphenyl)-1-methylpiperazine-2,5-dione |
| SMILES | CN1CC(=O)N[C@@H](c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C11H12N2O3/c1-13-6-9(15)12-10(11(13)16)7-2-4-8(14)5-3-7/h2-5,10,14H,6H2,1H3,(H,12,15)/t10-/m0/s1 |
| InChIKey | BVWMYSUAOJXKBK-JTQLQIEISA-N |
| XLogP | 0.02 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |