C10H12N2O2 — CID 174408760
2-(4-hydroxyphenyl)-1-methylimidazolidin-4-one (PubChem CID 174408760) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-1-methylimidazolidin-4-one.
| Compound Name | 2-(4-hydroxyphenyl)-1-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 174408760 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(4-hydroxyphenyl)-1-methylimidazolidin-4-one |
| SMILES | CN1CC(=O)NC1c1ccc(O)cc1 |
| InChI | InChI=1S/C10H12N2O2/c1-12-6-9(14)11-10(12)7-2-4-8(13)5-3-7/h2-5,10,13H,6H2,1H3,(H,11,14) |
| InChIKey | NHRSVAGHHPMVTQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |