C12H10F6N2O — CID 97325512
(2S)-2-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-4-one (PubChem CID 97325512) has the molecular formula C12H10F6N2O and a molecular weight of 312.21 g/mol. Its IUPAC name is (2S)-2-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-4-one.
| Compound Name | (2S)-2-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 97325512 |
| Molecular Formula | C12H10F6N2O |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (2S)-2-[3,5-bis(trifluoromethyl)phenyl]-1-methylimidazolidin-4-one |
| SMILES | CN1CC(=O)N[C@@H]1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F6N2O/c1-20-5-9(21)19-10(20)6-2-7(11(13,14)15)4-8(3-6)12(16,17)18/h2-4,10H,5H2,1H3,(H,19,21)/t10-/m0/s1 |
| InChIKey | NZOIGTBNIDTPLH-JTQLQIEISA-N |
| XLogP | 2.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |