C9H9NO3 — CID 105437865
5-(4-hydroxyphenyl)-1,2-oxazolidin-3-one (PubChem CID 105437865) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-1,2-oxazolidin-3-one.
| Compound Name | 5-(4-hydroxyphenyl)-1,2-oxazolidin-3-one |
|---|---|
| PubChem CID | 105437865 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 5-(4-hydroxyphenyl)-1,2-oxazolidin-3-one |
| SMILES | O=C1CC(c2ccc(O)cc2)ON1 |
| InChI | InChI=1S/C9H9NO3/c11-7-3-1-6(2-4-7)8-5-9(12)10-13-8/h1-4,8,11H,5H2,(H,10,12) |
| InChIKey | MBEGFPLWAGKLRR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |