C20H18O4 — CID 163038939
1,4-bis(4-hydroxyphenyl)-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione (PubChem CID 163038939) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is 1,4-bis(4-hydroxyphenyl)-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione.
| Compound Name | 1,4-bis(4-hydroxyphenyl)-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione |
|---|---|
| PubChem CID | 163038939 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1,4-bis(4-hydroxyphenyl)-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione |
| SMILES | O=C1CC2C(c3ccc(O)cc3)C(=O)CC2C1c1ccc(O)cc1 |
| InChI | InChI=1S/C20H18O4/c21-13-5-1-11(2-6-13)19-15-9-18(24)20(16(15)10-17(19)23)12-3-7-14(22)8-4-12/h1-8,15-16,19-22H,9-10H2 |
| InChIKey | OQFYSXOKUCVHQD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |