C11H10O3 — CID 163536929
2-(4-hydroxyphenyl)cyclopentane-1,3-dione (PubChem CID 163536929) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)cyclopentane-1,3-dione.
| Compound Name | 2-(4-hydroxyphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 163536929 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2-(4-hydroxyphenyl)cyclopentane-1,3-dione |
| SMILES | O=C1CCC(=O)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C11H10O3/c12-8-3-1-7(2-4-8)11-9(13)5-6-10(11)14/h1-4,11-12H,5-6H2 |
| InChIKey | DXUHSZSIYODSAR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|