C26H22O4 — CID 177391216
(2Z,6Z)-4-(4-hydroxyphenyl)-2,6-bis[(4-hydroxyphenyl)methylidene]cyclohexan-1-one (PubChem CID 177391216) has the molecular formula C26H22O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is (2Z,6Z)-4-(4-hydroxyphenyl)-2,6-bis[(4-hydroxyphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2Z,6Z)-4-(4-hydroxyphenyl)-2,6-bis[(4-hydroxyphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 177391216 |
| Molecular Formula | C26H22O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (2Z,6Z)-4-(4-hydroxyphenyl)-2,6-bis[(4-hydroxyphenyl)methylidene]cyclohexan-1-one |
| SMILES | O=C1/C(=C\c2ccc(O)cc2)CC(c2ccc(O)cc2)C/C1=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C26H22O4/c27-23-7-1-17(2-8-23)13-21-15-20(19-5-11-25(29)12-6-19)16-22(26(21)30)14-18-3-9-24(28)10-4-18/h1-14,20,27-29H,15-16H2/b21-13-,22-14- |
| InChIKey | FMVXDCBABRQGFZ-JZTLMNBPSA-N |
| XLogP | 5.42 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|