C22H18O4 — CID 143780159
(1E,3R)-3-(4-hydroxyphenyl)-1-[(4-hydroxyphenyl)methylidene]-2,3-dihydroindene-4,6-diol (PubChem CID 143780159) has the molecular formula C22H18O4 and a molecular weight of 346.38 g/mol. Its IUPAC name is (1E,3R)-3-(4-hydroxyphenyl)-1-[(4-hydroxyphenyl)methylidene]-2,3-dihydroindene-4,6-diol.
| Compound Name | (1E,3R)-3-(4-hydroxyphenyl)-1-[(4-hydroxyphenyl)methylidene]-2,3-dihydroindene-4,6-diol |
|---|---|
| PubChem CID | 143780159 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (1E,3R)-3-(4-hydroxyphenyl)-1-[(4-hydroxyphenyl)methylidene]-2,3-dihydroindene-4,6-diol |
| SMILES | Oc1ccc(/C=C2\C[C@H](c3ccc(O)cc3)c3c(O)cc(O)cc32)cc1 |
| InChI | InChI=1S/C22H18O4/c23-16-5-1-13(2-6-16)9-15-10-19(14-3-7-17(24)8-4-14)22-20(15)11-18(25)12-21(22)26/h1-9,11-12,19,23-26H,10H2/b15-9+/t19-/m1/s1 |
| InChIKey | NDTAUCOGCVQFQN-RNYZQXAPSA-N |
| XLogP | 4.59 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|