C19H16O3 — CID 162162773
2,3-bis[(4-hydroxyphenyl)methylidene]cyclopentan-1-one (PubChem CID 162162773) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2,3-bis[(4-hydroxyphenyl)methylidene]cyclopentan-1-one.
| Compound Name | 2,3-bis[(4-hydroxyphenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 162162773 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2,3-bis[(4-hydroxyphenyl)methylidene]cyclopentan-1-one |
| SMILES | O=C1CCC(=Cc2ccc(O)cc2)C1=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C19H16O3/c20-16-6-1-13(2-7-16)11-15-5-10-19(22)18(15)12-14-3-8-17(21)9-4-14/h1-4,6-9,11-12,20-21H,5,10H2 |
| InChIKey | ZMSCCCQIMMTCRZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|