C14H30N2OSi — CID 22982962
CID 22982962 (PubChem CID 22982962) has the molecular formula C14H30N2OSi and a molecular weight of 270.49 g/mol.
| Compound Name | CID 22982962 |
|---|---|
| PubChem CID | 22982962 |
| Molecular Formula | C14H30N2OSi |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | — |
| SMILES | CCO[Si]CCCNC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C14H30N2OSi/c1-6-17-18-9-7-8-15-12-10-13(2,3)16-14(4,5)11-12/h12,15-16H,6-11H2,1-5H3 |
| InChIKey | OUWGMMQBANYRGD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|