C28H56N2O3 — CID 122414862
1-butoxy-2,2,7,7-tetramethyl-4-[4-(2,2,7,7-tetramethylazepan-4-yl)oxybutoxy]azepane (PubChem CID 122414862) has the molecular formula C28H56N2O3 and a molecular weight of 468.77 g/mol. Its IUPAC name is 1-butoxy-2,2,7,7-tetramethyl-4-[4-(2,2,7,7-tetramethylazepan-4-yl)oxybutoxy]azepane.
| Compound Name | 1-butoxy-2,2,7,7-tetramethyl-4-[4-(2,2,7,7-tetramethylazepan-4-yl)oxybutoxy]azepane |
|---|---|
| PubChem CID | 122414862 |
| Molecular Formula | C28H56N2O3 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.43 |
| IUPAC Name | 1-butoxy-2,2,7,7-tetramethyl-4-[4-(2,2,7,7-tetramethylazepan-4-yl)oxybutoxy]azepane |
| SMILES | CCCCON1C(C)(C)CCC(OCCCCOC2CCC(C)(C)NC(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C28H56N2O3/c1-10-11-20-33-30-27(6,7)17-15-24(22-28(30,8)9)32-19-13-12-18-31-23-14-16-25(2,3)29-26(4,5)21-23/h23-24,29H,10-22H2,1-9H3 |
| InChIKey | WWDMTSQKKPGUFP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|