C31H54N2O4 — CID 122414936
1-hydroxy-2,2,7,7-tetramethyl-4-[4-(2,2,7,7-tetramethyl-1-pentoxyazepan-4-yl)oxyphenoxy]azepane (PubChem CID 122414936) has the molecular formula C31H54N2O4 and a molecular weight of 518.78 g/mol. Its IUPAC name is 1-hydroxy-2,2,7,7-tetramethyl-4-[4-(2,2,7,7-tetramethyl-1-pentoxyazepan-4-yl)oxyphenoxy]azepane.
| Compound Name | 1-hydroxy-2,2,7,7-tetramethyl-4-[4-(2,2,7,7-tetramethyl-1-pentoxyazepan-4-yl)oxyphenoxy]azepane |
|---|---|
| PubChem CID | 122414936 |
| Molecular Formula | C31H54N2O4 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.41 |
| IUPAC Name | 1-hydroxy-2,2,7,7-tetramethyl-4-[4-(2,2,7,7-tetramethyl-1-pentoxyazepan-4-yl)oxyphenoxy]azepane |
| SMILES | CCCCCON1C(C)(C)CCC(Oc2ccc(OC3CCC(C)(C)N(O)C(C)(C)C3)cc2)CC1(C)C |
| InChI | InChI=1S/C31H54N2O4/c1-10-11-12-21-35-33-29(4,5)20-18-27(23-31(33,8)9)37-25-15-13-24(14-16-25)36-26-17-19-28(2,3)32(34)30(6,7)22-26/h13-16,26-27,34H,10-12,17-23H2,1-9H3 |
| InChIKey | LWLQXBAANUSDSN-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|