C28H47NO4 — CID 54197471
1-(4-ethenylphenoxy)-3-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxypropan-2-ol (PubChem CID 54197471) has the molecular formula C28H47NO4 and a molecular weight of 461.69 g/mol. Its IUPAC name is 1-(4-ethenylphenoxy)-3-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxypropan-2-ol.
| Compound Name | 1-(4-ethenylphenoxy)-3-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxypropan-2-ol |
|---|---|
| PubChem CID | 54197471 |
| Molecular Formula | C28H47NO4 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.35 |
| IUPAC Name | 1-(4-ethenylphenoxy)-3-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxypropan-2-ol |
| SMILES | C=Cc1ccc(OCC(O)COC2CC(C)(C)N(OCCCCCCCC)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C28H47NO4/c1-7-9-10-11-12-13-18-33-29-27(3,4)19-26(20-28(29,5)6)32-22-24(30)21-31-25-16-14-23(8-2)15-17-25/h8,14-17,24,26,30H,2,7,9-13,18-22H2,1,3-6H3 |
| InChIKey | PMVYUFXRHBWWDZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|