C29H52N2O6 — CID 129212703
1-O-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl) 4-O-(1-methoxy-2,2,7,7-tetramethylazepan-4-yl) cyclohexane-1,4-dicarboxylate (PubChem CID 129212703) has the molecular formula C29H52N2O6 and a molecular weight of 524.74 g/mol. Its IUPAC name is 1-O-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl) 4-O-(1-methoxy-2,2,7,7-tetramethylazepan-4-yl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 1-O-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl) 4-O-(1-methoxy-2,2,7,7-tetramethylazepan-4-yl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 129212703 |
| Molecular Formula | C29H52N2O6 |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.38 |
| IUPAC Name | 1-O-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl) 4-O-(1-methoxy-2,2,7,7-tetramethylazepan-4-yl) cyclohexane-1,4-dicarboxylate |
| SMILES | CON1C(C)(C)CCC(OC(=O)C2CCC(C(=O)OC3CCC(C)(C)N(O)C(C)(C)C3)CC2)CC1(C)C |
| InChI | InChI=1S/C29H52N2O6/c1-26(2)16-14-22(18-28(5,6)30(26)34)36-24(32)20-10-12-21(13-11-20)25(33)37-23-15-17-27(3,4)31(35-9)29(7,8)19-23/h20-23,34H,10-19H2,1-9H3 |
| InChIKey | OAEQWGPKDVBXQC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |