C41H81N3O6 — CID 122414997
3-[1,5-bis[(1-butoxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxy]pentoxy]-1-butoxy-2,2,5,5-tetramethylpyrrolidine (PubChem CID 122414997) has the molecular formula C41H81N3O6 and a molecular weight of 712.11 g/mol. Its IUPAC name is 3-[1,5-bis[(1-butoxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxy]pentoxy]-1-butoxy-2,2,5,5-tetramethylpyrrolidine.
| Compound Name | 3-[1,5-bis[(1-butoxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxy]pentoxy]-1-butoxy-2,2,5,5-tetramethylpyrrolidine |
|---|---|
| PubChem CID | 122414997 |
| Molecular Formula | C41H81N3O6 |
| Molecular Weight | 712.11 g/mol |
| Exact Mass | 711.61 |
| IUPAC Name | 3-[1,5-bis[(1-butoxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxy]pentoxy]-1-butoxy-2,2,5,5-tetramethylpyrrolidine |
| SMILES | CCCCON1C(C)(C)CC(OCCCCC(OC2CC(C)(C)N(OCCCC)C2(C)C)OC2CC(C)(C)N(OCCCC)C2(C)C)C1(C)C |
| InChI | InChI=1S/C41H81N3O6/c1-16-19-26-46-42-36(4,5)29-32(39(42,10)11)45-25-23-22-24-35(49-33-30-37(6,7)43(40(33,12)13)47-27-20-17-2)50-34-31-38(8,9)44(41(34,14)15)48-28-21-18-3/h32-35H,16-31H2,1-15H3 |
| InChIKey | AGPCJTBZRXKQPZ-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.11 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|