C26H54N4O2 — CID 23372122
1-[1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)oxyoctoxy]-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 23372122) has the molecular formula C26H54N4O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is 1-[1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)oxyoctoxy]-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | 1-[1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)oxyoctoxy]-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 23372122 |
| Molecular Formula | C26H54N4O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.42 |
| IUPAC Name | 1-[1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)oxyoctoxy]-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CCCCCCCC(ON1C(C)(C)CC(N)CC1(C)C)ON1C(C)(C)CC(N)CC1(C)C |
| InChI | InChI=1S/C26H54N4O2/c1-10-11-12-13-14-15-22(31-29-23(2,3)16-20(27)17-24(29,4)5)32-30-25(6,7)18-21(28)19-26(30,8)9/h20-22H,10-19,27-28H2,1-9H3 |
| InChIKey | HXZNYZPSMVJVEB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|