C13H26NO+ — CID 154706988
1-butoxy-2,2,6,6-tetramethyl-4,5-dihydro-3H-pyridin-4-ylium (PubChem CID 154706988) has the molecular formula C13H26NO+ and a molecular weight of 212.36 g/mol. Its IUPAC name is 1-butoxy-2,2,6,6-tetramethyl-4,5-dihydro-3H-pyridin-4-ylium.
| Compound Name | 1-butoxy-2,2,6,6-tetramethyl-4,5-dihydro-3H-pyridin-4-ylium |
|---|---|
| PubChem CID | 154706988 |
| Molecular Formula | C13H26NO+ |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | 1-butoxy-2,2,6,6-tetramethyl-4,5-dihydro-3H-pyridin-4-ylium |
| SMILES | CCCCON1C(C)(C)C[CH+]CC1(C)C |
| InChI | InChI=1S/C13H26NO/c1-6-7-11-15-14-12(2,3)9-8-10-13(14,4)5/h8H,6-7,9-11H2,1-5H3/q+1 |
| InChIKey | FHMDSLOGZNKCBP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|