C21H37Cl2N5O — CID 87307781
N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethyl-1-pentoxypiperidin-4-yl)-1,3,5-triazin-2-amine (PubChem CID 87307781) has the molecular formula C21H37Cl2N5O and a molecular weight of 446.47 g/mol. Its IUPAC name is N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethyl-1-pentoxypiperidin-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethyl-1-pentoxypiperidin-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 87307781 |
| Molecular Formula | C21H37Cl2N5O |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethyl-1-pentoxypiperidin-4-yl)-1,3,5-triazin-2-amine |
| SMILES | CCCCCON1C(C)(C)CC(N(CCCC)c2nc(Cl)nc(Cl)n2)CC1(C)C |
| InChI | InChI=1S/C21H37Cl2N5O/c1-7-9-11-13-29-28-20(3,4)14-16(15-21(28,5)6)27(12-10-8-2)19-25-17(22)24-18(23)26-19/h16H,7-15H2,1-6H3 |
| InChIKey | XUAJAGZWZJNMGQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|