C14H31I2NO2SiV — CID 160801494
diiodovanadium;methoxy-dimethyl-[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxymethyl]silane (PubChem CID 160801494) has the molecular formula C14H31I2NO2SiV and a molecular weight of 578.25 g/mol. Its IUPAC name is diiodovanadium;methoxy-dimethyl-[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxymethyl]silane.
| Compound Name | diiodovanadium;methoxy-dimethyl-[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxymethyl]silane |
|---|---|
| PubChem CID | 160801494 |
| Molecular Formula | C14H31I2NO2SiV |
| Molecular Weight | 578.25 g/mol |
| Exact Mass | 577.97 |
| IUPAC Name | diiodovanadium;methoxy-dimethyl-[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxymethyl]silane |
| SMILES | CO[Si](C)(C)COC1CC(C)(C)N(C)C(C)(C)C1.I[V]I |
| InChI | InChI=1S/C14H31NO2Si.2HI.V/c1-13(2)9-12(10-14(3,4)15(13)5)17-11-18(7,8)16-6;;;/h12H,9-11H2,1-8H3;2*1H;/q;;;+2/p-2 |
| InChIKey | SDCZSZWTXKBRLX-UHFFFAOYSA-L |
| XLogP | 4.81 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.25 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|