C31H61NO4 — CID 91317203
1,2,2,6,6-pentamethyl-4-[8-[(3,3,4,5,5-pentamethylcyclohexyl)oxymethoxy]octoxymethoxy]piperidine (PubChem CID 91317203) has the molecular formula C31H61NO4 and a molecular weight of 511.83 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-4-[8-[(3,3,4,5,5-pentamethylcyclohexyl)oxymethoxy]octoxymethoxy]piperidine.
| Compound Name | 1,2,2,6,6-pentamethyl-4-[8-[(3,3,4,5,5-pentamethylcyclohexyl)oxymethoxy]octoxymethoxy]piperidine |
|---|---|
| PubChem CID | 91317203 |
| Molecular Formula | C31H61NO4 |
| Molecular Weight | 511.83 g/mol |
| Exact Mass | 511.46 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-4-[8-[(3,3,4,5,5-pentamethylcyclohexyl)oxymethoxy]octoxymethoxy]piperidine |
| SMILES | CC1C(C)(C)CC(OCOCCCCCCCCOCOC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C31H61NO4/c1-25-28(2,3)19-26(20-29(25,4)5)35-23-33-17-15-13-11-12-14-16-18-34-24-36-27-21-30(6,7)32(10)31(8,9)22-27/h25-27H,11-24H2,1-10H3 |
| InChIKey | GEQCRQGTAVOKFX-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.83 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|