C33H47NO3 — CID 163298209
(1,2,2,6,6-pentamethylpiperidin-4-yl) 4-[4-[4-(4-methylcyclohexyl)phenyl]phenoxy]butanoate (PubChem CID 163298209) has the molecular formula C33H47NO3 and a molecular weight of 505.74 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) 4-[4-[4-(4-methylcyclohexyl)phenyl]phenoxy]butanoate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 4-[4-[4-(4-methylcyclohexyl)phenyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 163298209 |
| Molecular Formula | C33H47NO3 |
| Molecular Weight | 505.74 g/mol |
| Exact Mass | 505.36 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 4-[4-[4-(4-methylcyclohexyl)phenyl]phenoxy]butanoate |
| SMILES | CC1CCC(c2ccc(-c3ccc(OCCCC(=O)OC4CC(C)(C)N(C)C(C)(C)C4)cc3)cc2)CC1 |
| InChI | InChI=1S/C33H47NO3/c1-24-9-11-25(12-10-24)26-13-15-27(16-14-26)28-17-19-29(20-18-28)36-21-7-8-31(35)37-30-22-32(2,3)34(6)33(4,5)23-30/h13-20,24-25,30H,7-12,21-23H2,1-6H3 |
| InChIKey | XSLIBEDDXCIVLQ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.74 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|