C33H50FNO — CID 134486421
1-but-3-enyl-4-[2-fluoro-4-[5-[4-[(E)-prop-1-enyl]cyclohexyl]oxan-2-yl]phenyl]-2,2,6,6-tetramethylpiperidine (PubChem CID 134486421) has the molecular formula C33H50FNO and a molecular weight of 495.77 g/mol. Its IUPAC name is 1-but-3-enyl-4-[2-fluoro-4-[5-[4-[(E)-prop-1-enyl]cyclohexyl]oxan-2-yl]phenyl]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-but-3-enyl-4-[2-fluoro-4-[5-[4-[(E)-prop-1-enyl]cyclohexyl]oxan-2-yl]phenyl]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 134486421 |
| Molecular Formula | C33H50FNO |
| Molecular Weight | 495.77 g/mol |
| Exact Mass | 495.39 |
| IUPAC Name | 1-but-3-enyl-4-[2-fluoro-4-[5-[4-[(E)-prop-1-enyl]cyclohexyl]oxan-2-yl]phenyl]-2,2,6,6-tetramethylpiperidine |
| SMILES | C=CCCN1C(C)(C)CC(c2ccc(C3CCC(C4CCC(/C=C/C)CC4)CO3)cc2F)CC1(C)C |
| InChI | InChI=1S/C33H50FNO/c1-7-9-19-35-32(3,4)21-28(22-33(35,5)6)29-17-15-26(20-30(29)34)31-18-16-27(23-36-31)25-13-11-24(10-8-2)12-14-25/h7-8,10,15,17,20,24-25,27-28,31H,1,9,11-14,16,18-19,21-23H2,2-6H3/b10-8+ |
| InChIKey | AVVVCRIEYSJCIM-CSKARUKUSA-N |
| XLogP | 8.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.77 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|