C28H44FNO — CID 134486608
1-but-3-enyl-4-[2-fluoro-4-(4-propoxycyclohexyl)phenyl]-2,2,6,6-tetramethylpiperidine (PubChem CID 134486608) has the molecular formula C28H44FNO and a molecular weight of 429.66 g/mol. Its IUPAC name is 1-but-3-enyl-4-[2-fluoro-4-(4-propoxycyclohexyl)phenyl]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-but-3-enyl-4-[2-fluoro-4-(4-propoxycyclohexyl)phenyl]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 134486608 |
| Molecular Formula | C28H44FNO |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | 1-but-3-enyl-4-[2-fluoro-4-(4-propoxycyclohexyl)phenyl]-2,2,6,6-tetramethylpiperidine |
| SMILES | C=CCCN1C(C)(C)CC(c2ccc(C3CCC(OCCC)CC3)cc2F)CC1(C)C |
| InChI | InChI=1S/C28H44FNO/c1-7-9-16-30-27(3,4)19-23(20-28(30,5)6)25-15-12-22(18-26(25)29)21-10-13-24(14-11-21)31-17-8-2/h7,12,15,18,21,23-24H,1,8-11,13-14,16-17,19-20H2,2-6H3 |
| InChIKey | XGDCQIZQGLEKTJ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|