C27H44FNO — CID 134486645
4-[3-fluoro-4-(4-pentylcyclohexyl)phenyl]-1-methoxy-2,2,6,6-tetramethylpiperidine (PubChem CID 134486645) has the molecular formula C27H44FNO and a molecular weight of 417.65 g/mol. Its IUPAC name is 4-[3-fluoro-4-(4-pentylcyclohexyl)phenyl]-1-methoxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[3-fluoro-4-(4-pentylcyclohexyl)phenyl]-1-methoxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 134486645 |
| Molecular Formula | C27H44FNO |
| Molecular Weight | 417.65 g/mol |
| Exact Mass | 417.34 |
| IUPAC Name | 4-[3-fluoro-4-(4-pentylcyclohexyl)phenyl]-1-methoxy-2,2,6,6-tetramethylpiperidine |
| SMILES | CCCCCC1CCC(c2ccc(C3CC(C)(C)N(OC)C(C)(C)C3)cc2F)CC1 |
| InChI | InChI=1S/C27H44FNO/c1-7-8-9-10-20-11-13-21(14-12-20)24-16-15-22(17-25(24)28)23-18-26(2,3)29(30-6)27(4,5)19-23/h15-17,20-21,23H,7-14,18-19H2,1-6H3 |
| InChIKey | OROILFWPWXADLB-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.65 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|