C27H43NO3 — CID 134486581
[4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)phenyl] 4-butylcyclohexane-1-carboxylate (PubChem CID 134486581) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is [4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)phenyl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)phenyl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 134486581 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | [4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)phenyl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc(C3CC(C)(C)N(OC)C(C)(C)C3)cc2)CC1 |
| InChI | InChI=1S/C27H43NO3/c1-7-8-9-20-10-12-22(13-11-20)25(29)31-24-16-14-21(15-17-24)23-18-26(2,3)28(30-6)27(4,5)19-23/h14-17,20,22-23H,7-13,18-19H2,1-6H3 |
| InChIKey | UIIBOYSJABIDQZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|