C24H36O2 — CID 23334749
[4-(4-methylcyclohexyl)phenyl] 4-butylcyclohexane-1-carboxylate (PubChem CID 23334749) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is [4-(4-methylcyclohexyl)phenyl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [4-(4-methylcyclohexyl)phenyl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 23334749 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | [4-(4-methylcyclohexyl)phenyl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc(C3CCC(C)CC3)cc2)CC1 |
| InChI | InChI=1S/C24H36O2/c1-3-4-5-19-8-12-22(13-9-19)24(25)26-23-16-14-21(15-17-23)20-10-6-18(2)7-11-20/h14-20,22H,3-13H2,1-2H3 |
| InChIKey | MMHCOUHLGSHMSW-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|