C33H48FNO2 — CID 134244502
N-[2-[4-[4-[4-(4-but-3-enylcyclohexyl)-2-fluorophenyl]cyclohexyl]cyclohexyl]oxyethyl]prop-2-enamide (PubChem CID 134244502) has the molecular formula C33H48FNO2 and a molecular weight of 509.75 g/mol. Its IUPAC name is N-[2-[4-[4-[4-(4-but-3-enylcyclohexyl)-2-fluorophenyl]cyclohexyl]cyclohexyl]oxyethyl]prop-2-enamide.
| Compound Name | N-[2-[4-[4-[4-(4-but-3-enylcyclohexyl)-2-fluorophenyl]cyclohexyl]cyclohexyl]oxyethyl]prop-2-enamide |
|---|---|
| PubChem CID | 134244502 |
| Molecular Formula | C33H48FNO2 |
| Molecular Weight | 509.75 g/mol |
| Exact Mass | 509.37 |
| IUPAC Name | N-[2-[4-[4-[4-(4-but-3-enylcyclohexyl)-2-fluorophenyl]cyclohexyl]cyclohexyl]oxyethyl]prop-2-enamide |
| SMILES | C=CCCC1CCC(c2ccc(C3CCC(C4CCC(OCCNC(=O)C=C)CC4)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C33H48FNO2/c1-3-5-6-24-7-9-27(10-8-24)29-17-20-31(32(34)23-29)28-13-11-25(12-14-28)26-15-18-30(19-16-26)37-22-21-35-33(36)4-2/h3-4,17,20,23-28,30H,1-2,5-16,18-19,21-22H2,(H,35,36) |
| InChIKey | MUIUSTTTYAMZKP-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.75 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|