C32H50FNO — CID 135218652
1-[[4-[4-[3-fluoro-4-(4-pentylcyclohexyl)phenyl]cyclohexyl]cyclohexyl]amino]prop-2-en-1-ol (PubChem CID 135218652) has the molecular formula C32H50FNO and a molecular weight of 483.76 g/mol. Its IUPAC name is 1-[[4-[4-[3-fluoro-4-(4-pentylcyclohexyl)phenyl]cyclohexyl]cyclohexyl]amino]prop-2-en-1-ol.
| Compound Name | 1-[[4-[4-[3-fluoro-4-(4-pentylcyclohexyl)phenyl]cyclohexyl]cyclohexyl]amino]prop-2-en-1-ol |
|---|---|
| PubChem CID | 135218652 |
| Molecular Formula | C32H50FNO |
| Molecular Weight | 483.76 g/mol |
| Exact Mass | 483.39 |
| IUPAC Name | 1-[[4-[4-[3-fluoro-4-(4-pentylcyclohexyl)phenyl]cyclohexyl]cyclohexyl]amino]prop-2-en-1-ol |
| SMILES | C=CC(O)NC1CCC(C2CCC(c3ccc(C4CCC(CCCCC)CC4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C32H50FNO/c1-3-5-6-7-23-8-10-27(11-9-23)30-21-18-28(22-31(30)33)26-14-12-24(13-15-26)25-16-19-29(20-17-25)34-32(35)4-2/h4,18,21-27,29,32,34-35H,2-3,5-17,19-20H2,1H3 |
| InChIKey | KVQKJTVICTZFOR-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.76 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|