C36H59NO — CID 166645752
1-[[4-[4-[3-ethyl-4-(4-pentylcyclohexyl)phenyl]cyclohexyl]cyclohexyl]methyl-methylamino]prop-2-en-1-ol (PubChem CID 166645752) has the molecular formula C36H59NO and a molecular weight of 521.87 g/mol. Its IUPAC name is 1-[[4-[4-[3-ethyl-4-(4-pentylcyclohexyl)phenyl]cyclohexyl]cyclohexyl]methyl-methylamino]prop-2-en-1-ol.
| Compound Name | 1-[[4-[4-[3-ethyl-4-(4-pentylcyclohexyl)phenyl]cyclohexyl]cyclohexyl]methyl-methylamino]prop-2-en-1-ol |
|---|---|
| PubChem CID | 166645752 |
| Molecular Formula | C36H59NO |
| Molecular Weight | 521.87 g/mol |
| Exact Mass | 521.46 |
| IUPAC Name | 1-[[4-[4-[3-ethyl-4-(4-pentylcyclohexyl)phenyl]cyclohexyl]cyclohexyl]methyl-methylamino]prop-2-en-1-ol |
| SMILES | C=CC(O)N(C)CC1CCC(C2CCC(c3ccc(C4CCC(CCCCC)CC4)c(CC)c3)CC2)CC1 |
| InChI | InChI=1S/C36H59NO/c1-5-8-9-10-27-11-17-33(18-12-27)35-24-23-34(25-29(35)6-2)32-21-19-31(20-22-32)30-15-13-28(14-16-30)26-37(4)36(38)7-3/h7,23-25,27-28,30-33,36,38H,3,5-6,8-22,26H2,1-2,4H3 |
| InChIKey | CDMBTHXDGBXBCK-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.87 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|