C32H46F4 — CID 123873096
1-(4-pentylcyclohexyl)-4-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]cyclohexyl]benzene (PubChem CID 123873096) has the molecular formula C32H46F4 and a molecular weight of 506.71 g/mol. Its IUPAC name is 1-(4-pentylcyclohexyl)-4-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1-(4-pentylcyclohexyl)-4-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 123873096 |
| Molecular Formula | C32H46F4 |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.35 |
| IUPAC Name | 1-(4-pentylcyclohexyl)-4-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]cyclohexyl]benzene |
| SMILES | CCCCCC1CCC(c2ccc(C3CCC(C4CCC(C(F)=CC(F)(F)F)CC4)CC3)cc2)CC1 |
| InChI | InChI=1S/C32H46F4/c1-2-3-4-5-23-6-8-24(9-7-23)25-10-12-26(13-11-25)27-14-16-28(17-15-27)29-18-20-30(21-19-29)31(33)22-32(34,35)36/h10-13,22-24,27-30H,2-9,14-21H2,1H3 |
| InChIKey | JKPQVEHMGBDJCJ-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|