C34H40F4 — CID 123660375
1-(4-pentylcyclohexyl)-4-[2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]phenyl]ethynyl]benzene (PubChem CID 123660375) has the molecular formula C34H40F4 and a molecular weight of 524.69 g/mol. Its IUPAC name is 1-(4-pentylcyclohexyl)-4-[2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]phenyl]ethynyl]benzene.
| Compound Name | 1-(4-pentylcyclohexyl)-4-[2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 123660375 |
| Molecular Formula | C34H40F4 |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | 1-(4-pentylcyclohexyl)-4-[2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]phenyl]ethynyl]benzene |
| SMILES | CCCCCC1CCC(c2ccc(C#Cc3ccc(C4CCC(C(F)=CC(F)(F)F)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C34H40F4/c1-2-3-4-5-25-8-14-28(15-9-25)29-16-10-26(11-17-29)6-7-27-12-18-30(19-13-27)31-20-22-32(23-21-31)33(35)24-34(36,37)38/h10-13,16-19,24-25,28,31-32H,2-5,8-9,14-15,20-23H2,1H3 |
| InChIKey | RMPQNJUSOMREJZ-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|