C26H26F4 — CID 123274036
1-propyl-4-[2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]phenyl]ethynyl]benzene (PubChem CID 123274036) has the molecular formula C26H26F4 and a molecular weight of 414.49 g/mol. Its IUPAC name is 1-propyl-4-[2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]phenyl]ethynyl]benzene.
| Compound Name | 1-propyl-4-[2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 123274036 |
| Molecular Formula | C26H26F4 |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 1-propyl-4-[2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]phenyl]ethynyl]benzene |
| SMILES | CCCc1ccc(C#Cc2ccc(C3CCC(C(F)=CC(F)(F)F)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H26F4/c1-2-3-19-4-6-20(7-5-19)8-9-21-10-12-22(13-11-21)23-14-16-24(17-15-23)25(27)18-26(28,29)30/h4-7,10-13,18,23-24H,2-3,14-17H2,1H3 |
| InChIKey | QXSRWOFKKWHAGN-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|