C31H44F4O — CID 123862596
5-(4-pentylcyclohexyl)-2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]phenyl]oxane (PubChem CID 123862596) has the molecular formula C31H44F4O and a molecular weight of 508.68 g/mol. Its IUPAC name is 5-(4-pentylcyclohexyl)-2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]phenyl]oxane.
| Compound Name | 5-(4-pentylcyclohexyl)-2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]phenyl]oxane |
|---|---|
| PubChem CID | 123862596 |
| Molecular Formula | C31H44F4O |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | 5-(4-pentylcyclohexyl)-2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]phenyl]oxane |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc(C4CCC(C(F)=CC(F)(F)F)CC4)cc3)OC2)CC1 |
| InChI | InChI=1S/C31H44F4O/c1-2-3-4-5-22-6-8-25(9-7-22)28-18-19-30(36-21-28)27-16-12-24(13-17-27)23-10-14-26(15-11-23)29(32)20-31(33,34)35/h12-13,16-17,20,22-23,25-26,28,30H,2-11,14-15,18-19,21H2,1H3 |
| InChIKey | FMHXVANGMNHTSI-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|