C31H42F6O — CID 123726896
2-[3,5-difluoro-4-(1,3,3,3-tetrafluoroprop-1-enyl)phenyl]-5-[4-(4-pentylcyclohexyl)cyclohexyl]oxane (PubChem CID 123726896) has the molecular formula C31H42F6O and a molecular weight of 544.66 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(1,3,3,3-tetrafluoroprop-1-enyl)phenyl]-5-[4-(4-pentylcyclohexyl)cyclohexyl]oxane.
| Compound Name | 2-[3,5-difluoro-4-(1,3,3,3-tetrafluoroprop-1-enyl)phenyl]-5-[4-(4-pentylcyclohexyl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 123726896 |
| Molecular Formula | C31H42F6O |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | 2-[3,5-difluoro-4-(1,3,3,3-tetrafluoroprop-1-enyl)phenyl]-5-[4-(4-pentylcyclohexyl)cyclohexyl]oxane |
| SMILES | CCCCCC1CCC(C2CCC(C3CCC(c4cc(F)c(C(F)=CC(F)(F)F)c(F)c4)OC3)CC2)CC1 |
| InChI | InChI=1S/C31H42F6O/c1-2-3-4-5-20-6-8-21(9-7-20)22-10-12-23(13-11-22)24-14-15-29(38-19-24)25-16-26(32)30(27(33)17-25)28(34)18-31(35,36)37/h16-18,20-24,29H,2-15,19H2,1H3 |
| InChIKey | LZKBLEVVOGOGIF-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|