C33H52F4O — CID 123480399
5-[4-[2-(4-pentylcyclohexyl)ethenyl]cyclohexyl]-2-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]oxane (PubChem CID 123480399) has the molecular formula C33H52F4O and a molecular weight of 540.77 g/mol. Its IUPAC name is 5-[4-[2-(4-pentylcyclohexyl)ethenyl]cyclohexyl]-2-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]oxane.
| Compound Name | 5-[4-[2-(4-pentylcyclohexyl)ethenyl]cyclohexyl]-2-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 123480399 |
| Molecular Formula | C33H52F4O |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.40 |
| IUPAC Name | 5-[4-[2-(4-pentylcyclohexyl)ethenyl]cyclohexyl]-2-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]oxane |
| SMILES | CCCCCC1CCC(C=CC2CCC(C3CCC(C4CCC(C(F)=CC(F)(F)F)CC4)OC3)CC2)CC1 |
| InChI | InChI=1S/C33H52F4O/c1-2-3-4-5-24-6-8-25(9-7-24)10-11-26-12-14-27(15-13-26)30-20-21-32(38-23-30)29-18-16-28(17-19-29)31(34)22-33(35,36)37/h10-11,22,24-30,32H,2-9,12-21,23H2,1H3 |
| InChIKey | ZKCLNURCDYIEPR-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|