C18H26F4O2 — CID 123450659
5-propyl-2-[2-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]ethenyl]-1,3-dioxane (PubChem CID 123450659) has the molecular formula C18H26F4O2 and a molecular weight of 350.40 g/mol. Its IUPAC name is 5-propyl-2-[2-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]ethenyl]-1,3-dioxane.
| Compound Name | 5-propyl-2-[2-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]ethenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 123450659 |
| Molecular Formula | C18H26F4O2 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 5-propyl-2-[2-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]ethenyl]-1,3-dioxane |
| SMILES | CCCC1COC(C=CC2CCC(C(F)=CC(F)(F)F)CC2)OC1 |
| InChI | InChI=1S/C18H26F4O2/c1-2-3-14-11-23-17(24-12-14)9-6-13-4-7-15(8-5-13)16(19)10-18(20,21)22/h6,9-10,13-15,17H,2-5,7-8,11-12H2,1H3 |
| InChIKey | UVWAXDINLKEIFO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|