C23H40O2 — CID 70829400
[4-[5-[(E)-2-(4-propylcyclohexyl)ethenyl]oxan-2-yl]cyclohexyl]methanol (PubChem CID 70829400) has the molecular formula C23H40O2 and a molecular weight of 348.57 g/mol. Its IUPAC name is [4-[5-[(E)-2-(4-propylcyclohexyl)ethenyl]oxan-2-yl]cyclohexyl]methanol.
| Compound Name | [4-[5-[(E)-2-(4-propylcyclohexyl)ethenyl]oxan-2-yl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 70829400 |
| Molecular Formula | C23H40O2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | [4-[5-[(E)-2-(4-propylcyclohexyl)ethenyl]oxan-2-yl]cyclohexyl]methanol |
| SMILES | CCCC1CCC(/C=C/C2CCC(C3CCC(CO)CC3)OC2)CC1 |
| InChI | InChI=1S/C23H40O2/c1-2-3-18-4-6-19(7-5-18)8-9-21-12-15-23(25-17-21)22-13-10-20(16-24)11-14-22/h8-9,18-24H,2-7,10-17H2,1H3/b9-8+ |
| InChIKey | CBWFLHRHJKMABF-CMDGGOBGSA-N |
| XLogP | 5.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|