C30H40F6O2 — CID 123153909
2-[4-[3,5-difluoro-4-(1,3,3,3-tetrafluoroprop-1-enyl)phenyl]cyclohexyl]-5-(4-pentylcyclohexyl)-1,3-dioxane (PubChem CID 123153909) has the molecular formula C30H40F6O2 and a molecular weight of 546.64 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-(1,3,3,3-tetrafluoroprop-1-enyl)phenyl]cyclohexyl]-5-(4-pentylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-[4-[3,5-difluoro-4-(1,3,3,3-tetrafluoroprop-1-enyl)phenyl]cyclohexyl]-5-(4-pentylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 123153909 |
| Molecular Formula | C30H40F6O2 |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-(1,3,3,3-tetrafluoroprop-1-enyl)phenyl]cyclohexyl]-5-(4-pentylcyclohexyl)-1,3-dioxane |
| SMILES | CCCCCC1CCC(C2COC(C3CCC(c4cc(F)c(C(F)=CC(F)(F)F)c(F)c4)CC3)OC2)CC1 |
| InChI | InChI=1S/C30H40F6O2/c1-2-3-4-5-19-6-8-21(9-7-19)24-17-37-29(38-18-24)22-12-10-20(11-13-22)23-14-25(31)28(26(32)15-23)27(33)16-30(34,35)36/h14-16,19-22,24,29H,2-13,17-18H2,1H3 |
| InChIKey | YMUDIWDSGWPTGU-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|