C25H35F3O3 — CID 25031641
5-(4-butylcyclohexyl)-2-[6-(3,4,5-trifluorophenyl)oxan-3-yl]-1,3-dioxane (PubChem CID 25031641) has the molecular formula C25H35F3O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is 5-(4-butylcyclohexyl)-2-[6-(3,4,5-trifluorophenyl)oxan-3-yl]-1,3-dioxane.
| Compound Name | 5-(4-butylcyclohexyl)-2-[6-(3,4,5-trifluorophenyl)oxan-3-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 25031641 |
| Molecular Formula | C25H35F3O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 5-(4-butylcyclohexyl)-2-[6-(3,4,5-trifluorophenyl)oxan-3-yl]-1,3-dioxane |
| SMILES | CCCCC1CCC(C2COC(C3CCC(c4cc(F)c(F)c(F)c4)OC3)OC2)CC1 |
| InChI | InChI=1S/C25H35F3O3/c1-2-3-4-16-5-7-17(8-6-16)20-14-30-25(31-15-20)18-9-10-23(29-13-18)19-11-21(26)24(28)22(27)12-19/h11-12,16-18,20,23,25H,2-10,13-15H2,1H3 |
| InChIKey | LQRQEACLTXZFJS-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|