C25H35F2NO2 — CID 54568073
2,6-difluoro-4-[5-(4-octylcyclohexyl)-1,3-dioxan-2-yl]benzonitrile (PubChem CID 54568073) has the molecular formula C25H35F2NO2 and a molecular weight of 419.56 g/mol. Its IUPAC name is 2,6-difluoro-4-[5-(4-octylcyclohexyl)-1,3-dioxan-2-yl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[5-(4-octylcyclohexyl)-1,3-dioxan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 54568073 |
| Molecular Formula | C25H35F2NO2 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 2,6-difluoro-4-[5-(4-octylcyclohexyl)-1,3-dioxan-2-yl]benzonitrile |
| SMILES | CCCCCCCCC1CCC(C2COC(c3cc(F)c(C#N)c(F)c3)OC2)CC1 |
| InChI | InChI=1S/C25H35F2NO2/c1-2-3-4-5-6-7-8-18-9-11-19(12-10-18)21-16-29-25(30-17-21)20-13-23(26)22(15-28)24(27)14-20/h13-14,18-19,21,25H,2-12,16-17H2,1H3 |
| InChIKey | ZVGILJIYKRBAMZ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|