C22H29F2N — CID 58839980
2,6-difluoro-4-(1,1,3-trideuterio-6-pentyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-2-yl)benzonitrile (PubChem CID 58839980) has the molecular formula C22H29F2N and a molecular weight of 348.50 g/mol. Its IUPAC name is 2,6-difluoro-4-(1,1,3-trideuterio-6-pentyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-2-yl)benzonitrile.
| Compound Name | 2,6-difluoro-4-(1,1,3-trideuterio-6-pentyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-2-yl)benzonitrile |
|---|---|
| PubChem CID | 58839980 |
| Molecular Formula | C22H29F2N |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 2,6-difluoro-4-(1,1,3-trideuterio-6-pentyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-2-yl)benzonitrile |
| SMILES | [2H]C1CC2CC(CCCCC)CCC2C([2H])([2H])C1c1cc(F)c(C#N)c(F)c1 |
| InChI | InChI=1S/C22H29F2N/c1-2-3-4-5-15-6-7-17-11-18(9-8-16(17)10-15)19-12-21(23)20(14-25)22(24)13-19/h12-13,15-18H,2-11H2,1H3/i9D,11D2 |
| InChIKey | QPBCRTBPMVVFFH-QHWHNHRWSA-N |
| XLogP | 6.72 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|