C17H21F2N — CID 173360724
4-(3-butylcyclohexyl)-2,6-difluorobenzonitrile (PubChem CID 173360724) has the molecular formula C17H21F2N and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-(3-butylcyclohexyl)-2,6-difluorobenzonitrile.
| Compound Name | 4-(3-butylcyclohexyl)-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 173360724 |
| Molecular Formula | C17H21F2N |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 4-(3-butylcyclohexyl)-2,6-difluorobenzonitrile |
| SMILES | CCCCC1CCCC(c2cc(F)c(C#N)c(F)c2)C1 |
| InChI | InChI=1S/C17H21F2N/c1-2-3-5-12-6-4-7-13(8-12)14-9-16(18)15(11-20)17(19)10-14/h9-10,12-13H,2-8H2,1H3 |
| InChIKey | YKFBWIIEISRGBD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |