C24H25F4NO2 — CID 121324117
4-[[4-(4-butylcyclohexyl)-2,6-difluorophenyl]-hydroperoxymethyl]-2,6-difluorobenzonitrile (PubChem CID 121324117) has the molecular formula C24H25F4NO2 and a molecular weight of 435.46 g/mol. Its IUPAC name is 4-[[4-(4-butylcyclohexyl)-2,6-difluorophenyl]-hydroperoxymethyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[[4-(4-butylcyclohexyl)-2,6-difluorophenyl]-hydroperoxymethyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 121324117 |
| Molecular Formula | C24H25F4NO2 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 4-[[4-(4-butylcyclohexyl)-2,6-difluorophenyl]-hydroperoxymethyl]-2,6-difluorobenzonitrile |
| SMILES | CCCCC1CCC(c2cc(F)c(C(OO)c3cc(F)c(C#N)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C24H25F4NO2/c1-2-3-4-14-5-7-15(8-6-14)16-9-21(27)23(22(28)10-16)24(31-30)17-11-19(25)18(13-29)20(26)12-17/h9-12,14-15,24,30H,2-8H2,1H3 |
| InChIKey | DDFZYTZSHCOUOU-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|