C23H23F5O4 — CID 91603709
2-[6-[3,5-difluoro-4-[(3,4,5-trifluorophenoxy)methyl]phenyl]oxan-3-yl]-5-methyl-1,3-dioxane (PubChem CID 91603709) has the molecular formula C23H23F5O4 and a molecular weight of 458.42 g/mol. Its IUPAC name is 2-[6-[3,5-difluoro-4-[(3,4,5-trifluorophenoxy)methyl]phenyl]oxan-3-yl]-5-methyl-1,3-dioxane.
| Compound Name | 2-[6-[3,5-difluoro-4-[(3,4,5-trifluorophenoxy)methyl]phenyl]oxan-3-yl]-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 91603709 |
| Molecular Formula | C23H23F5O4 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 2-[6-[3,5-difluoro-4-[(3,4,5-trifluorophenoxy)methyl]phenyl]oxan-3-yl]-5-methyl-1,3-dioxane |
| SMILES | CC1COC(C2CCC(c3cc(F)c(COc4cc(F)c(F)c(F)c4)c(F)c3)OC2)OC1 |
| InChI | InChI=1S/C23H23F5O4/c1-12-8-31-23(32-9-12)13-2-3-21(30-10-13)14-4-17(24)16(18(25)5-14)11-29-15-6-19(26)22(28)20(27)7-15/h4-7,12-13,21,23H,2-3,8-11H2,1H3 |
| InChIKey | RCRPXQVTOJXXCL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|