C24H26F6O4 — CID 90811057
1,3-difluoro-5-(fluoromethoxy)-2-methylbenzene;5-(5-methyloxan-2-yl)-2-(3,4,5-trifluorophenyl)-1,3-dioxane (PubChem CID 90811057) has the molecular formula C24H26F6O4 and a molecular weight of 492.46 g/mol. Its IUPAC name is 1,3-difluoro-5-(fluoromethoxy)-2-methylbenzene;5-(5-methyloxan-2-yl)-2-(3,4,5-trifluorophenyl)-1,3-dioxane.
| Compound Name | 1,3-difluoro-5-(fluoromethoxy)-2-methylbenzene;5-(5-methyloxan-2-yl)-2-(3,4,5-trifluorophenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 90811057 |
| Molecular Formula | C24H26F6O4 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 1,3-difluoro-5-(fluoromethoxy)-2-methylbenzene;5-(5-methyloxan-2-yl)-2-(3,4,5-trifluorophenyl)-1,3-dioxane |
| SMILES | CC1CCC(C2COC(c3cc(F)c(F)c(F)c3)OC2)OC1.Cc1c(F)cc(OCF)cc1F |
| InChI | InChI=1S/C16H19F3O3.C8H7F3O/c1-9-2-3-14(20-6-9)11-7-21-16(22-8-11)10-4-12(17)15(19)13(18)5-10;1-5-7(10)2-6(12-4-9)3-8(5)11/h4-5,9,11,14,16H,2-3,6-8H2,1H3;2-3H,4H2,1H3 |
| InChIKey | PJOKETDDCSPMOZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|