C27H24F6O5 — CID 145140764
2-(3,5-difluoro-4-methylphenyl)-5-(ethoxymethyl)-1,3-dioxane;[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl] formate (PubChem CID 145140764) has the molecular formula C27H24F6O5 and a molecular weight of 542.47 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-methylphenyl)-5-(ethoxymethyl)-1,3-dioxane;[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl] formate.
| Compound Name | 2-(3,5-difluoro-4-methylphenyl)-5-(ethoxymethyl)-1,3-dioxane;[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl] formate |
|---|---|
| PubChem CID | 145140764 |
| Molecular Formula | C27H24F6O5 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 2-(3,5-difluoro-4-methylphenyl)-5-(ethoxymethyl)-1,3-dioxane;[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl] formate |
| SMILES | CCOCC1COC(c2cc(F)c(C)c(F)c2)OC1.O=COc1ccc(-c2cc(F)c(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C14H18F2O3.C13H6F4O2/c1-3-17-6-10-7-18-14(19-8-10)11-4-12(15)9(2)13(16)5-11;14-10-5-8(19-6-18)1-2-9(10)7-3-11(15)13(17)12(16)4-7/h4-5,10,14H,3,6-8H2,1-2H3;1-6H |
| InChIKey | YKJAVTCAZYANJO-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|