C30H23F5O3 — CID 130218085
5-[[2,6-difluoro-4-[4-(4-methylphenyl)phenyl]phenoxy]methyl]-2-(3,4,5-trifluorophenyl)-1,3-dioxane (PubChem CID 130218085) has the molecular formula C30H23F5O3 and a molecular weight of 526.50 g/mol. Its IUPAC name is 5-[[2,6-difluoro-4-[4-(4-methylphenyl)phenyl]phenoxy]methyl]-2-(3,4,5-trifluorophenyl)-1,3-dioxane.
| Compound Name | 5-[[2,6-difluoro-4-[4-(4-methylphenyl)phenyl]phenoxy]methyl]-2-(3,4,5-trifluorophenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 130218085 |
| Molecular Formula | C30H23F5O3 |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 5-[[2,6-difluoro-4-[4-(4-methylphenyl)phenyl]phenoxy]methyl]-2-(3,4,5-trifluorophenyl)-1,3-dioxane |
| SMILES | Cc1ccc(-c2ccc(-c3cc(F)c(OCC4COC(c5cc(F)c(F)c(F)c5)OC4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C30H23F5O3/c1-17-2-4-19(5-3-17)20-6-8-21(9-7-20)22-10-26(33)29(27(34)11-22)36-14-18-15-37-30(38-16-18)23-12-24(31)28(35)25(32)13-23/h2-13,18,30H,14-16H2,1H3 |
| InChIKey | MBVRNRFMKKDXCN-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|