C28H21F5O3 — CID 130218002
5-[(2,6-difluoro-4-methylphenoxy)methyl]-2-[4-(5,6,7-trifluoronaphthalen-2-yl)phenyl]-1,3-dioxane (PubChem CID 130218002) has the molecular formula C28H21F5O3 and a molecular weight of 500.46 g/mol. Its IUPAC name is 5-[(2,6-difluoro-4-methylphenoxy)methyl]-2-[4-(5,6,7-trifluoronaphthalen-2-yl)phenyl]-1,3-dioxane.
| Compound Name | 5-[(2,6-difluoro-4-methylphenoxy)methyl]-2-[4-(5,6,7-trifluoronaphthalen-2-yl)phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 130218002 |
| Molecular Formula | C28H21F5O3 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 5-[(2,6-difluoro-4-methylphenoxy)methyl]-2-[4-(5,6,7-trifluoronaphthalen-2-yl)phenyl]-1,3-dioxane |
| SMILES | Cc1cc(F)c(OCC2COC(c3ccc(-c4ccc5c(F)c(F)c(F)cc5c4)cc3)OC2)c(F)c1 |
| InChI | InChI=1S/C28H21F5O3/c1-15-8-23(30)27(24(31)9-15)34-12-16-13-35-28(36-14-16)18-4-2-17(3-5-18)19-6-7-21-20(10-19)11-22(29)26(33)25(21)32/h2-11,16,28H,12-14H2,1H3 |
| InChIKey | YHMQSZZHPAOWBT-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|